CAS 939043-41-1 appears in our catalog under these names: 3-Amino-6-Boc-6-azabenzocycloheptane, tert-Butyl 8-amino-4,5-dihydro-1H-benzo(c)azepine-2(3H)-carboxylate. Offered by: TRC, Biosynth. Available pack sizes: 2,5g, 1g, 100mg.
Tert-butyl 8-amino-1,3,4,5-tetrahydro-2-benzazepine-2-carboxylate (CAS 939043-41-1) is a chemical compound with the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. IUPAC name: tert-butyl 8-amino-1,3,4,5-tetrahydro-2-benzazepine-2-carboxylate. InChIKey: SGTDQRPCUHNRFJ-UHFFFAOYSA-N.
| Molecular formula | C15H22N2O2 |
|---|---|
| Molecular weight | 262.35 g/mol |
| IUPAC name | tert-butyl 8-amino-1,3,4,5-tetrahydro-2-benzazepine-2-carboxylate |
| InChIKey | SGTDQRPCUHNRFJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC2=C(C1)C=C(C=C2)N |
Computed by PubChem (NCBI)