Products 939437-33-9
CAS 939437-33-9 is the registry number for 1-Methyl-5-oxo-2-(pyridin-3-yl)pyrrolidine-3-carboxamide, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 100mg, 250mg, 1g.
1-methyl-5-oxo-2-pyridin-3-ylpyrrolidine-3-carboxamide (CAS 939437-33-9) is a chemical compound with the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. IUPAC name: 1-methyl-5-oxo-2-pyridin-3-ylpyrrolidine-3-carboxamide. InChIKey: AOUSFDDFFDPVFF-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O2 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | 1-methyl-5-oxo-2-pyridin-3-ylpyrrolidine-3-carboxamide |
| InChIKey | AOUSFDDFFDPVFF-UHFFFAOYSA-N |
| SMILES | CN1C(C(CC1=O)C(=O)N)C2=CN=CC=C2 |
Computed by PubChem (NCBI)