CAS 814263-30-4 appears in our catalog under these names: 5-(Boc-amino)-2-cyanopyridine, 98%, tert-Butyl 6-Cyanopyridin-3-ylcarbamate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 10g.
Tert-butyl N-(6-cyano-3-pyridinyl)carbamate (CAS 814263-30-4) is a chemical compound with the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. IUPAC name: tert-butyl N-(6-cyano-3-pyridinyl)carbamate. InChIKey: PORXJOIBOYMOMQ-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O2 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | tert-butyl N-(6-cyano-3-pyridinyl)carbamate |
| InChIKey | PORXJOIBOYMOMQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CN=C(C=C1)C#N |
Computed by PubChem (NCBI)