Products 130384-98-4
CAS 130384-98-4 appears in our catalog under these names: N-Boc-benzotriazole, 95%, tert-Butyl 1H-benzo(d)(1,2,3)triazole-1-carboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 25g.
Tert-butyl benzotriazole-1-carboxylate (CAS 130384-98-4) is a chemical compound with the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. IUPAC name: tert-butyl benzotriazole-1-carboxylate. InChIKey: NWMQPTCDOIQMHM-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O2 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | tert-butyl benzotriazole-1-carboxylate |
| InChIKey | NWMQPTCDOIQMHM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2=CC=CC=C2N=N1 |
Computed by PubChem (NCBI)