CAS 93951-92-9 is the registry number for 1,2-(Diphenyl-d10)hydrazine. Offered by: TRC. Available pack sizes: 100mg.
1,2-bis(2,3,4,5,6-pentadeuteriophenyl)hydrazine (CAS 93951-92-9) is a chemical compound with the molecular formula C12H12N2 and a molecular weight of 194.30 g/mol. IUPAC name: 1,2-bis(2,3,4,5,6-pentadeuteriophenyl)hydrazine. InChIKey: YBQZXXMEJHZYMB-LHNTUAQVSA-N.
| Molecular formula | C12H12N2 |
|---|---|
| Molecular weight | 194.30 g/mol |
| IUPAC name | 1,2-bis(2,3,4,5,6-pentadeuteriophenyl)hydrazine |
| InChIKey | YBQZXXMEJHZYMB-LHNTUAQVSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])NNC2=C(C(=C(C(=C2[2H])[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)