CAS 93957-54-1 appears in our catalog under these names: Fluvastatin/ 98.94% (existing batch purity), Fluvastatin, Fluvastatin, 98+%, 98+%, Fluvastatin (Standard), Fluvastatin, 98.49%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso), 100 mg, 10mM/1mL.
(E,3S,5R)-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enoic acid (CAS 93957-54-1) is a chemical compound with the molecular formula C24H26FNO4 and a molecular weight of 411.5 g/mol. IUPAC name: (E,3S,5R)-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enoic acid. InChIKey: FJLGEFLZQAZZCD-JUFISIKESA-N.
| Molecular formula | C24H26FNO4 |
|---|---|
| Molecular weight | 411.5 g/mol |
| IUPAC name | (E,3S,5R)-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enoic acid |
| InChIKey | FJLGEFLZQAZZCD-JUFISIKESA-N |
| SMILES | CC(C)N1C2=CC=CC=C2C(=C1/C=C/[C@@H](C[C@@H](CC(=O)O)O)O)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)