Products 94010-78-3
CAS 94010-78-3 appears in our catalog under these names: Difluoro(4-fluorophenyl)acetic acid, 95%, 2,2-Difluoro-2-(4-fluorophenyl)acetic Acid, 2，2–Difluoro–2–(4–fluorophenyl)acetic Acid, 2,2-Difluoro-2-(4-fluorophenyl)acetic Acid 98%, 2，2-Difluoro-2-(4-fluorophenyl)acetic Acid, 98%, 98%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Ambeed. Available pack sizes: 1g, 5g, 2,5g, 250mg, 100mg, 50mg, 500mg, 1000mg.
2,2-difluoro-2-(4-fluorophenyl)acetic acid (CAS 94010-78-3) is a chemical compound with the molecular formula C8H5F3O2 and a molecular weight of 190.12 g/mol. IUPAC name: 2,2-difluoro-2-(4-fluorophenyl)acetic acid. InChIKey: POBKFWBINPQWMW-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O2 |
|---|---|
| Molecular weight | 190.12 g/mol |
| IUPAC name | 2,2-difluoro-2-(4-fluorophenyl)acetic acid |
| InChIKey | POBKFWBINPQWMW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(=O)O)(F)F)F |
Computed by PubChem (NCBI)