Products 940476-20-0
CAS 940476-20-0 is the registry number for ANO61. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-methyl-N-[3-(propan-2-ylcarbamoyl)phenyl]benzamide (CAS 940476-20-0) is a chemical compound with the molecular formula C18H20N2O2 and a molecular weight of 296.4 g/mol. IUPAC name: 3-methyl-N-[3-(propan-2-ylcarbamoyl)phenyl]benzamide. InChIKey: OBXQJKLXJNGZKZ-UHFFFAOYSA-N.
| Molecular formula | C18H20N2O2 |
|---|---|
| Molecular weight | 296.4 g/mol |
| IUPAC name | 3-methyl-N-[3-(propan-2-ylcarbamoyl)phenyl]benzamide |
| InChIKey | OBXQJKLXJNGZKZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C(=O)NC2=CC=CC(=C2)C(=O)NC(C)C |
Computed by PubChem (NCBI)