Products 94058-85-2
CAS 94058-85-2 is the registry number for 5-Chloro-2-morpholinobenzo(d)oxazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g, 50g.
5-chloro-2-morpholin-4-yl-1,3-benzoxazole (CAS 94058-85-2) is a chemical compound with the molecular formula C11H11ClN2O2 and a molecular weight of 238.67 g/mol. IUPAC name: 5-chloro-2-morpholin-4-yl-1,3-benzoxazole. InChIKey: LDOYAIFMBIJNAG-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2O2 |
|---|---|
| Molecular weight | 238.67 g/mol |
| IUPAC name | 5-chloro-2-morpholin-4-yl-1,3-benzoxazole |
| InChIKey | LDOYAIFMBIJNAG-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=NC3=C(O2)C=CC(=C3)Cl |
Computed by PubChem (NCBI)