Products 941280-51-9
CAS 941280-51-9 appears in our catalog under these names: 2-(3-Bromophenyl)-3-(4-chlorophenyl)propanoic acid, 95%, 2-(3-Bromophenyl)-3-(4-chlorophenyl)propanoic acid, 97%. Offered by: Ambeed, Fluorochem, BLDpharm, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
2-(3-bromophenyl)-3-(4-chlorophenyl)propanoic acid (CAS 941280-51-9) is a chemical compound with the molecular formula C15H12BrClO2 and a molecular weight of 339.61 g/mol. IUPAC name: 2-(3-bromophenyl)-3-(4-chlorophenyl)propanoic acid. InChIKey: HMACGKZYWDFEKR-UHFFFAOYSA-N.
| Molecular formula | C15H12BrClO2 |
|---|---|
| Molecular weight | 339.61 g/mol |
| IUPAC name | 2-(3-bromophenyl)-3-(4-chlorophenyl)propanoic acid |
| InChIKey | HMACGKZYWDFEKR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(CC2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)