CAS 941400-35-7 appears in our catalog under these names: 2-Chloro-n-(3-fluorophenyl)propanamide, 95%, N-(3-Fluorophenyl)-2-chloropropanamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 25g.
2-chloro-N-(3-fluorophenyl)propanamide (CAS 941400-35-7) is a chemical compound with the molecular formula C9H9ClFNO and a molecular weight of 201.62 g/mol. IUPAC name: 2-chloro-N-(3-fluorophenyl)propanamide. InChIKey: VJXUKJYCXBVIJL-UHFFFAOYSA-N.
| Molecular formula | C9H9ClFNO |
|---|---|
| Molecular weight | 201.62 g/mol |
| IUPAC name | 2-chloro-N-(3-fluorophenyl)propanamide |
| InChIKey | VJXUKJYCXBVIJL-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=CC(=CC=C1)F)Cl |
Computed by PubChem (NCBI)