CAS 94160-98-2 appears in our catalog under these names: (R)-Quinuclidine-2-carboxylic acid hydrochloride, 97%, (R)-quinuclidine-2-carboxylic acid hydrochloride, 95%, (R)-quinuclidine-2-carboxylic acid hydrochloride, 95%, 95%. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 50mg, 1g, 5g, 100mg, 250mg.
(2R)-1-azabicyclo[2.2.2]octane-2-carboxylic acid;hydrochloride (CAS 94160-98-2) is a chemical compound with the molecular formula C8H14ClNO2 and a molecular weight of 191.65 g/mol. IUPAC name: (2R)-1-azabicyclo[2.2.2]octane-2-carboxylic acid;hydrochloride. InChIKey: JOIJZJVAIURHGA-OGFXRTJISA-N.
| Molecular formula | C8H14ClNO2 |
|---|---|
| Molecular weight | 191.65 g/mol |
| IUPAC name | (2R)-1-azabicyclo[2.2.2]octane-2-carboxylic acid;hydrochloride |
| InChIKey | JOIJZJVAIURHGA-OGFXRTJISA-N |
| SMILES | C1CN2CCC1C[C@@H]2C(=O)O.Cl |
Computed by PubChem (NCBI)