Products 942077-16-9
CAS 942077-16-9 appears in our catalog under these names: 3–Cyano–5–(trifluoromethyl)benzoic Acid, 3-Cyano-5-(trifluoromethyl)benzoic Acid, 3-Cyano-5-(trifluoromethyl)benzoic Acid, 95%, 95%, 3-CYANO-5-(TRIFLUOROMETHYL)BENZOIC ACID, 98%, 3-Cyano-5-(trifluoromethyl)benzoic Acid, 95%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g, 2,5g, 25g, 100mg, 10g.
3-cyano-5-(trifluoromethyl)benzoic acid (CAS 942077-16-9) is a chemical compound with the molecular formula C9H4F3NO2 and a molecular weight of 215.13 g/mol. IUPAC name: 3-cyano-5-(trifluoromethyl)benzoic acid. InChIKey: CILFQQDMSXNYDM-UHFFFAOYSA-N.
| Molecular formula | C9H4F3NO2 |
|---|---|
| Molecular weight | 215.13 g/mol |
| IUPAC name | 3-cyano-5-(trifluoromethyl)benzoic acid |
| InChIKey | CILFQQDMSXNYDM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)C(F)(F)F)C#N |
Computed by PubChem (NCBI)