CAS 942189-96-0 appears in our catalog under these names: Methyl 1-Boc-3-fluoropyrrolidine-3-carboxylate, 95%, 1–(tert–butyl) 3–methyl 3–fluoropyrrolidine–1,3–dicarboxylate, 1-tert-Butyl 3-methyl 3-fluoropyrrolidine-1,3-dicarboxylate 95%, 1-tert-Butyl 3-methyl 3-fluoropyrrolidine-1,3-dicarboxylate, 97%, 97%, 1-TERT-BUTYL 3-METHYL 3-FLUOROPYRROLIDINE-1,3-DICARBOXYLATE, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g.
1-O-tert-butyl 3-O-methyl 3-fluoropyrrolidine-1,3-dicarboxylate (CAS 942189-96-0) is a chemical compound with the molecular formula C11H18FNO4 and a molecular weight of 247.26 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl 3-fluoropyrrolidine-1,3-dicarboxylate. InChIKey: WJXDMHSZPKIZKP-UHFFFAOYSA-N.
| Molecular formula | C11H18FNO4 |
|---|---|
| Molecular weight | 247.26 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl 3-fluoropyrrolidine-1,3-dicarboxylate |
| InChIKey | WJXDMHSZPKIZKP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C1)(C(=O)OC)F |
Computed by PubChem (NCBI)