CAS 647857-39-4 appears in our catalog under these names: 1-tert-Butyl 2-methyl (2r,4s)-4-fluoropyrrolidine-1,2-dicarboxylate, 95%, 1–tert–Butyl 2–methyl (2R,4S)–4–fluoropyrrolidine–1,2–dicarboxylate, 1-(tert-Butyl) 2-methyl (2R,4S)-4-fluoropyrrolidine-1,2-dicarboxylate 97%, (2R,4S)-1-tert-Butyl 2-methyl 4-fluoropyrrolidine-1,2-dicarboxylate, 97%, 97%, 1-TERT-BUTYL 2-METHYL (2R,4S)-4-FLUOROPYRROLIDINE-1,2-DICARBOXYLATE, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg, 10g.
1-O-tert-butyl 2-O-methyl (2R,4S)-4-fluoropyrrolidine-1,2-dicarboxylate (CAS 647857-39-4) is a chemical compound with the molecular formula C11H18FNO4 and a molecular weight of 247.26 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2R,4S)-4-fluoropyrrolidine-1,2-dicarboxylate. InChIKey: METPQQHVRNLTRX-JGVFFNPUSA-N.
| Molecular formula | C11H18FNO4 |
|---|---|
| Molecular weight | 247.26 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2R,4S)-4-fluoropyrrolidine-1,2-dicarboxylate |
| InChIKey | METPQQHVRNLTRX-JGVFFNPUSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@@H]1C(=O)OC)F |
Computed by PubChem (NCBI)