CAS 942492-11-7 appears in our catalog under these names: tert-Butyl 4-amino-11-azatricyclo(6.2.1.0,2,7)undeca-2,4,6-triene-11-carboxylate, tert-Butyl 4-amino-11-azatricyclo(6.2.1.0,2,7)undeca-2,4,6-triene-11-carboxylate, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
Tert-butyl 4-amino-11-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene-11-carboxylate (CAS 942492-11-7) is a chemical compound with the molecular formula C15H20N2O2 and a molecular weight of 260.33 g/mol. IUPAC name: tert-butyl 4-amino-11-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene-11-carboxylate. InChIKey: RGNQFMYCOUARHV-UHFFFAOYSA-N.
| Molecular formula | C15H20N2O2 |
|---|---|
| Molecular weight | 260.33 g/mol |
| IUPAC name | tert-butyl 4-amino-11-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene-11-carboxylate |
| InChIKey | RGNQFMYCOUARHV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1C3=C2C=CC(=C3)N |
Computed by PubChem (NCBI)