CAS 94291-69-7 is the registry number for Carnitine Chloride Impurity 11. Offered by: Chemat Brand. Available pack sizes: on request.
(3-carboxy-2-oxopropyl)-trimethylazanium chloride (CAS 94291-69-7) is a chemical compound with the molecular formula C7H14ClNO3 and a molecular weight of 195.64 g/mol. IUPAC name: (3-carboxy-2-oxopropyl)-trimethylazanium chloride. InChIKey: ARJSRFNLTQWYDA-UHFFFAOYSA-N.
| Molecular formula | C7H14ClNO3 |
|---|---|
| Molecular weight | 195.64 g/mol |
| IUPAC name | (3-carboxy-2-oxopropyl)-trimethylazanium chloride |
| InChIKey | ARJSRFNLTQWYDA-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)CC(=O)CC(=O)O.[Cl-] |
Computed by PubChem (NCBI)