CAS 943311-50-0 appears in our catalog under these names: 6–Amino–5–fluoro–2,1–benzoxaborol–1(3H)–ol, 6-Amino-5-fluorobenzo[c][1,2]oxaborol-1(3H)-ol, 97%, 97%, 6-Amino-5-fluorobenzo[c][1,2]oxaborol-1(3H)-ol, 97%, 6-Amino-5-fluorobenzo[c][1,2]oxaborol-1(3H)-ol, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1mg, 5mg, 100mg, 250mg, 1g, 5g.
5-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-amine (CAS 943311-50-0) is a chemical compound with the molecular formula C7H7BFNO2 and a molecular weight of 166.95 g/mol. IUPAC name: 5-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-amine. InChIKey: OTNUPHBMWRIGJT-UHFFFAOYSA-N.
| Molecular formula | C7H7BFNO2 |
|---|---|
| Molecular weight | 166.95 g/mol |
| IUPAC name | 5-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-amine |
| InChIKey | OTNUPHBMWRIGJT-UHFFFAOYSA-N |
| SMILES | B1(C2=CC(=C(C=C2CO1)F)N)O |
Computed by PubChem (NCBI)