CAS 947165-29-9 appears in our catalog under these names: 4-Amino-6-fluorobenzo[c][1,2]oxaborol-1(3H)-ol, 95%, 95%, 4-Amino-6-fluorobenzo[c][1,2]oxaborol-1(3H)-ol, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
6-fluoro-1-hydroxy-3H-2,1-benzoxaborol-4-amine (CAS 947165-29-9) is a chemical compound with the molecular formula C7H7BFNO2 and a molecular weight of 166.95 g/mol. IUPAC name: 6-fluoro-1-hydroxy-3H-2,1-benzoxaborol-4-amine. InChIKey: NRTPJGCCUPAAHO-UHFFFAOYSA-N.
| Molecular formula | C7H7BFNO2 |
|---|---|
| Molecular weight | 166.95 g/mol |
| IUPAC name | 6-fluoro-1-hydroxy-3H-2,1-benzoxaborol-4-amine |
| InChIKey | NRTPJGCCUPAAHO-UHFFFAOYSA-N |
| SMILES | B1(C2=CC(=CC(=C2CO1)N)F)O |
Computed by PubChem (NCBI)