Products 94346-09-5

CAS 94346-09-5 is the registry number for Plinyl Acetate. Offered by: Chemat Brand, HPC Standards. Available pack sizes: on request, 1x100mg.

Structural formula: {0} (CAS {1})

(1,2-dimethyl-3-prop-1-en-2-ylcyclopentyl) acetate (CAS 94346-09-5) is a chemical compound with the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. IUPAC name: (1,2-dimethyl-3-prop-1-en-2-ylcyclopentyl) acetate. InChIKey: NKWCOKZUKIEZAR-UHFFFAOYSA-N.

Identity
Molecular formulaC12H20O2
Molecular weight196.29 g/mol
IUPAC name(1,2-dimethyl-3-prop-1-en-2-ylcyclopentyl) acetate
InChIKeyNKWCOKZUKIEZAR-UHFFFAOYSA-N
SMILESCC1C(CCC1(C)OC(=O)C)C(=C)C

Computed by PubChem (NCBI)