Products 944898-21-9

CAS 944898-21-9 is the registry number for 5-(3-Cyanophenyl)-1,3,4-oxadiazole-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-(3-cyanophenyl)-1,3,4-oxadiazole-2-carboxylic acid (CAS 944898-21-9) is a chemical compound with the molecular formula C10H5N3O3 and a molecular weight of 215.16 g/mol. IUPAC name: 5-(3-cyanophenyl)-1,3,4-oxadiazole-2-carboxylic acid. InChIKey: IPLDRWBJUFWSES-UHFFFAOYSA-N.

Identity
Molecular formulaC10H5N3O3
Molecular weight215.16 g/mol
IUPAC name5-(3-cyanophenyl)-1,3,4-oxadiazole-2-carboxylic acid
InChIKeyIPLDRWBJUFWSES-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)C2=NN=C(O2)C(=O)O)C#N

Computed by PubChem (NCBI)