CAS 1342223-83-9 appears in our catalog under these names: 5-(3-Cyanophenyl)-1,2,4-oxadiazole-3-carboxylic acid, 95%, 5-(3-Cyanophenyl)-1,2,4-oxadiazole-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-(3-cyanophenyl)-1,2,4-oxadiazole-3-carboxylic acid (CAS 1342223-83-9) is a chemical compound with the molecular formula C10H5N3O3 and a molecular weight of 215.16 g/mol. IUPAC name: 5-(3-cyanophenyl)-1,2,4-oxadiazole-3-carboxylic acid. InChIKey: CXEHYAKXSRNEEZ-UHFFFAOYSA-N.
| Molecular formula | C10H5N3O3 |
|---|---|
| Molecular weight | 215.16 g/mol |
| IUPAC name | 5-(3-cyanophenyl)-1,2,4-oxadiazole-3-carboxylic acid |
| InChIKey | CXEHYAKXSRNEEZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=NC(=NO2)C(=O)O)C#N |
Computed by PubChem (NCBI)