Products 28657-78-5
CAS 28657-78-5 appears in our catalog under these names: Cinoxacin Impurity 4, 4-Hydroxy(1,3)dioxolo(4,5-g)cinnoline-3-carbonitrile. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1g, 2,5g, 500mg.
4-oxo-1H-[1,3]dioxolo[4,5-g]cinnoline-3-carbonitrile (CAS 28657-78-5) is a chemical compound with the molecular formula C10H5N3O3 and a molecular weight of 215.16 g/mol. IUPAC name: 4-oxo-1H-[1,3]dioxolo[4,5-g]cinnoline-3-carbonitrile. InChIKey: QHUWVFLGUJTSDV-UHFFFAOYSA-N.
| Molecular formula | C10H5N3O3 |
|---|---|
| Molecular weight | 215.16 g/mol |
| IUPAC name | 4-oxo-1H-[1,3]dioxolo[4,5-g]cinnoline-3-carbonitrile |
| InChIKey | QHUWVFLGUJTSDV-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C3C(=C2)C(=O)C(=NN3)C#N |
Computed by PubChem (NCBI)