Products 944904-72-7
CAS 944904-72-7 is the registry number for tert-butyl N-(3-formyl-1H-indazol-6-yl)carbamate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl N-(3-formyl-2H-indazol-6-yl)carbamate (CAS 944904-72-7) is a chemical compound with the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. IUPAC name: tert-butyl N-(3-formyl-2H-indazol-6-yl)carbamate. InChIKey: XAHNMARJGZQJLW-UHFFFAOYSA-N.
| Molecular formula | C13H15N3O3 |
|---|---|
| Molecular weight | 261.28 g/mol |
| IUPAC name | tert-butyl N-(3-formyl-2H-indazol-6-yl)carbamate |
| InChIKey | XAHNMARJGZQJLW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC2=NNC(=C2C=C1)C=O |
Computed by PubChem (NCBI)