CAS 945373-72-8 is the registry number for 1-[1,1′:3′,1′′-Terphenyl]-5′-ylethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g.
1-(3,5-diphenylphenyl)ethanone (CAS 945373-72-8) is a chemical compound with the molecular formula C20H16O and a molecular weight of 272.3 g/mol. IUPAC name: 1-(3,5-diphenylphenyl)ethanone. InChIKey: XNNUAXHRCVVFMG-UHFFFAOYSA-N.
| Molecular formula | C20H16O |
|---|---|
| Molecular weight | 272.3 g/mol |
| IUPAC name | 1-(3,5-diphenylphenyl)ethanone |
| InChIKey | XNNUAXHRCVVFMG-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC(=C1)C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)