Products 853925-19-6
CAS 853925-19-6 is the registry number for 1,11,12,12a-Tetrahydro-benzopyren-3-one. Offered by: TRC. Available pack sizes: 10mg, 1mg.
2,11,12,12a-tetrahydro-1H-benzo[a]pyren-3-one (CAS 853925-19-6) is a chemical compound with the molecular formula C20H16O and a molecular weight of 272.3 g/mol. IUPAC name: 2,11,12,12a-tetrahydro-1H-benzo[a]pyren-3-one. InChIKey: CXZLQXBUKJCILW-UHFFFAOYSA-N.
| Molecular formula | C20H16O |
|---|---|
| Molecular weight | 272.3 g/mol |
| IUPAC name | 2,11,12,12a-tetrahydro-1H-benzo[a]pyren-3-one |
| InChIKey | CXZLQXBUKJCILW-UHFFFAOYSA-N |
| SMILES | C1CC2=C3C(=CC4=CC=CC=C24)C=CC5=C3C1CCC5=O |
Computed by PubChem (NCBI)