CAS 2001-23-2 appears in our catalog under these names: 1-([1,1'-Biphenyl]-4-yl)-2-phenylethanone, 95%, 1-([1,1'-Biphenyl]-4-yl)-2-phenylethanone, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg.
2-phenyl-1-(4-phenylphenyl)ethanone (CAS 2001-23-2) is a chemical compound with the molecular formula C20H16O and a molecular weight of 272.3 g/mol. IUPAC name: 2-phenyl-1-(4-phenylphenyl)ethanone. InChIKey: FNOSNNPSTLUBPC-UHFFFAOYSA-N.
| Molecular formula | C20H16O |
|---|---|
| Molecular weight | 272.3 g/mol |
| IUPAC name | 2-phenyl-1-(4-phenylphenyl)ethanone |
| InChIKey | FNOSNNPSTLUBPC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(=O)C2=CC=C(C=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)