Products 946493-27-2

CAS 946493-27-2 appears in our catalog under these names: 3,5–Dimethylpyrazine–2–carboxylic acid, 3,5-Dimethylpyrazine-2-carboxylic acid, 3,5-Dimethylpyrazine-2-carboxylic acid 98%, 3,5-Dimethylpyrazine-2-carboxylic acid, 98%, 3,5-Dimethylpyrazine-2-Carboxylic Acid, 98%, 98%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem, Chemat. Available pack sizes: 10g, 1g, 250mg, 5g, 0,5g, 100mg.

Structural formula: {0} (CAS {1})

3,5-dimethylpyrazine-2-carboxylic acid (CAS 946493-27-2) is a chemical compound with the molecular formula C7H8N2O2 and a molecular weight of 152.15 g/mol. IUPAC name: 3,5-dimethylpyrazine-2-carboxylic acid. InChIKey: QBTHZBYYZUTCNC-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8N2O2
Molecular weight152.15 g/mol
IUPAC name3,5-dimethylpyrazine-2-carboxylic acid
InChIKeyQBTHZBYYZUTCNC-UHFFFAOYSA-N
SMILESCC1=CN=C(C(=N1)C)C(=O)O

Computed by PubChem (NCBI)