CAS 946661-57-0 is the registry number for 2-(5-Bromo-2,3-dihydro-1H-inden-1-yl)isoindoline-1,3-dione, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-(5-bromo-2,3-dihydro-1H-inden-1-yl)isoindole-1,3-dione (CAS 946661-57-0) is a chemical compound with the molecular formula C17H12BrNO2 and a molecular weight of 342.2 g/mol. IUPAC name: 2-(5-bromo-2,3-dihydro-1H-inden-1-yl)isoindole-1,3-dione. InChIKey: SJQXEZATCHVUHR-UHFFFAOYSA-N.
| Molecular formula | C17H12BrNO2 |
|---|---|
| Molecular weight | 342.2 g/mol |
| IUPAC name | 2-(5-bromo-2,3-dihydro-1H-inden-1-yl)isoindole-1,3-dione |
| InChIKey | SJQXEZATCHVUHR-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1N3C(=O)C4=CC=CC=C4C3=O)C=CC(=C2)Br |
Computed by PubChem (NCBI)