CAS 330194-05-3 appears in our catalog under these names: 6-Bromo-2-(4-methylphenyl)quinoline-4-carboxylic acid, 95%, 6-Bromo-2-(p-tolyl)quinoline-4-carboxylic acid, 97%, 6-Bromo-2-p-tolylquinoline-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
6-bromo-2-(4-methylphenyl)quinoline-4-carboxylic acid (CAS 330194-05-3) is a chemical compound with the molecular formula C17H12BrNO2 and a molecular weight of 342.2 g/mol. IUPAC name: 6-bromo-2-(4-methylphenyl)quinoline-4-carboxylic acid. InChIKey: JOLHAGZYGBJFBE-UHFFFAOYSA-N.
| Molecular formula | C17H12BrNO2 |
|---|---|
| Molecular weight | 342.2 g/mol |
| IUPAC name | 6-bromo-2-(4-methylphenyl)quinoline-4-carboxylic acid |
| InChIKey | JOLHAGZYGBJFBE-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC3=C(C=C(C=C3)Br)C(=C2)C(=O)O |
Computed by PubChem (NCBI)