CAS 139781-14-9 appears in our catalog under these names: 3-Acetyl-6-bromo-4-phenylquinolin-2(1h)-one, 95%, 3–Acetyl–6–bromo–4–phenylquinolin–2(1H)–one. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
3-acetyl-6-bromo-4-phenyl-1H-quinolin-2-one (CAS 139781-14-9) is a chemical compound with the molecular formula C17H12BrNO2 and a molecular weight of 342.2 g/mol. IUPAC name: 3-acetyl-6-bromo-4-phenyl-1H-quinolin-2-one. InChIKey: FXROTDSWXRSXMK-UHFFFAOYSA-N.
| Molecular formula | C17H12BrNO2 |
|---|---|
| Molecular weight | 342.2 g/mol |
| IUPAC name | 3-acetyl-6-bromo-4-phenyl-1H-quinolin-2-one |
| InChIKey | FXROTDSWXRSXMK-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C2=C(C=CC(=C2)Br)NC1=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)