Products 94706-16-8
CAS 94706-16-8 is the registry number for 5,8-Dihydro-5,8-methanonaphtho[2,3-d][1,3]dioxole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5,7-dioxatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4(8),9,12-tetraene (CAS 94706-16-8) is a chemical compound with the molecular formula C12H10O2 and a molecular weight of 186.21 g/mol. IUPAC name: 5,7-dioxatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4(8),9,12-tetraene. InChIKey: WNCDNNMIDAJHEW-UHFFFAOYSA-N.
| Molecular formula | C12H10O2 |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | 5,7-dioxatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4(8),9,12-tetraene |
| InChIKey | WNCDNNMIDAJHEW-UHFFFAOYSA-N |
| SMILES | C1C2C=CC1C3=CC4=C(C=C23)OCO4 |
Computed by PubChem (NCBI)