CAS 947729-86-4 is the registry number for (S)-Methyl 6,6-dimethylmorpholine-3-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 100mg, 1g, 5g.
Methyl (3S)-6,6-dimethylmorpholine-3-carboxylate (CAS 947729-86-4) is a chemical compound with the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. IUPAC name: methyl (3S)-6,6-dimethylmorpholine-3-carboxylate. InChIKey: HIOMIOFBGFGDHW-LURJTMIESA-N.
| Molecular formula | C8H15NO3 |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | methyl (3S)-6,6-dimethylmorpholine-3-carboxylate |
| InChIKey | HIOMIOFBGFGDHW-LURJTMIESA-N |
| SMILES | CC1(CN[C@@H](CO1)C(=O)OC)C |
Computed by PubChem (NCBI)