CAS 948-19-6 appears in our catalog under these names: N,N-Dimethyltryptamine Oxide, N,N-Dimethyltryptamine Oxide, >95% (HPLC), N,N–DMT N–oxide, N,N-Dimethyltryptamine N-oxide, 99.8%. Offered by: Chemat Brand, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 250mg, 500mg, 50mg, 1mg, 5mg, 1 mg.
2-(1H-indol-3-yl)-N,N-dimethylethanamine oxide (CAS 948-19-6) is a chemical compound with the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. IUPAC name: 2-(1H-indol-3-yl)-N,N-dimethylethanamine oxide. InChIKey: FSRSWKRQDYWUFG-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O |
|---|---|
| Molecular weight | 204.27 g/mol |
| IUPAC name | 2-(1H-indol-3-yl)-N,N-dimethylethanamine oxide |
| InChIKey | FSRSWKRQDYWUFG-UHFFFAOYSA-N |
| SMILES | C[N+](C)(CCC1=CNC2=CC=CC=C21)[O-] |
Computed by PubChem (NCBI)