CAS 948294-46-0 appears in our catalog under these names: 2-Chloro-3-(2-chloroethyl)-6-bromoquinoline, 95%, 6-Bromo-2-chloro-3-(2-chloroethyl)quinoline, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
6-bromo-2-chloro-3-(2-chloroethyl)quinoline (CAS 948294-46-0) is a chemical compound with the molecular formula C11H8BrCl2N and a molecular weight of 304.99 g/mol. IUPAC name: 6-bromo-2-chloro-3-(2-chloroethyl)quinoline. InChIKey: HXRISNDQRQVHSH-UHFFFAOYSA-N.
| Molecular formula | C11H8BrCl2N |
|---|---|
| Molecular weight | 304.99 g/mol |
| IUPAC name | 6-bromo-2-chloro-3-(2-chloroethyl)quinoline |
| InChIKey | HXRISNDQRQVHSH-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=C(C=C2C=C1Br)CCCl)Cl |
Computed by PubChem (NCBI)