CAS 948294-53-9 is the registry number for 2-Chloro-3-(2-chloroethyl)-7-bromoquinoline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
7-bromo-2-chloro-3-(2-chloroethyl)quinoline (CAS 948294-53-9) is a chemical compound with the molecular formula C11H8BrCl2N and a molecular weight of 304.99 g/mol. IUPAC name: 7-bromo-2-chloro-3-(2-chloroethyl)quinoline. InChIKey: RAPFUVRBDXXAHY-UHFFFAOYSA-N.
| Molecular formula | C11H8BrCl2N |
|---|---|
| Molecular weight | 304.99 g/mol |
| IUPAC name | 7-bromo-2-chloro-3-(2-chloroethyl)quinoline |
| InChIKey | RAPFUVRBDXXAHY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=NC(=C(C=C21)CCCl)Cl)Br |
Computed by PubChem (NCBI)