CAS 94830-58-7 appears in our catalog under these names: 5-Benzyl-4,5-dihydro-1H-imidazol-2-amine, 95%, 5-Benzyl-4,5-dihydro-1H-imidazol-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 50mg, 0,5g.
5-benzyl-4,5-dihydro-1H-imidazol-2-amine (CAS 94830-58-7) is a chemical compound with the molecular formula C10H13N3 and a molecular weight of 175.23 g/mol. IUPAC name: 5-benzyl-4,5-dihydro-1H-imidazol-2-amine. InChIKey: OZKGTJHTWRZQLA-UHFFFAOYSA-N.
| Molecular formula | C10H13N3 |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | 5-benzyl-4,5-dihydro-1H-imidazol-2-amine |
| InChIKey | OZKGTJHTWRZQLA-UHFFFAOYSA-N |
| SMILES | C1C(NC(=N1)N)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)