Products 948552-52-1
CAS 948552-52-1 is the registry number for 2-(4-(2-Bromoethyl)phenyl)-2-methylpropanoic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[4-(2-bromoethyl)phenyl]-2-methylpropanoic acid (CAS 948552-52-1) is a chemical compound with the molecular formula C12H15BrO2 and a molecular weight of 271.15 g/mol. IUPAC name: 2-[4-(2-bromoethyl)phenyl]-2-methylpropanoic acid. InChIKey: IVJNMZYDZRRMRL-UHFFFAOYSA-N.
| Molecular formula | C12H15BrO2 |
|---|---|
| Molecular weight | 271.15 g/mol |
| IUPAC name | 2-[4-(2-bromoethyl)phenyl]-2-methylpropanoic acid |
| InChIKey | IVJNMZYDZRRMRL-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)CCBr)C(=O)O |
Computed by PubChem (NCBI)