Products 94888-34-3

CAS 94888-34-3 is the registry number for N-tert-Butoxycarbonyl-L-isoleucineamide. Offered by: Biosynth. Available pack sizes: 1g, 2g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[(2S,3S)-1-amino-3-methyl-1-oxopentan-2-yl]carbamate (CAS 94888-34-3) is a chemical compound with the molecular formula C11H22N2O3 and a molecular weight of 230.30 g/mol. IUPAC name: tert-butyl N-[(2S,3S)-1-amino-3-methyl-1-oxopentan-2-yl]carbamate. InChIKey: ZXLNERXKXKBCJS-YUMQZZPRSA-N.

Identity
Molecular formulaC11H22N2O3
Molecular weight230.30 g/mol
IUPAC nametert-butyl N-[(2S,3S)-1-amino-3-methyl-1-oxopentan-2-yl]carbamate
InChIKeyZXLNERXKXKBCJS-YUMQZZPRSA-N
SMILESCC[C@H](C)[C@@H](C(=O)N)NC(=O)OC(C)(C)C

Computed by PubChem (NCBI)