Products 948901-10-8
CAS 948901-10-8 appears in our catalog under these names: Antitumor agent–120, Antitumor agent-120, 96.0%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 1 mg, 5 mg.
5-methoxy-2-[4-(4-methoxyphenyl)-1H-pyrazol-5-yl]phenol (CAS 948901-10-8) is a chemical compound with the molecular formula C17H16N2O3 and a molecular weight of 296.32 g/mol. IUPAC name: 5-methoxy-2-[4-(4-methoxyphenyl)-1H-pyrazol-5-yl]phenol. InChIKey: HSFFXTIWNUXDGF-UHFFFAOYSA-N.
| Molecular formula | C17H16N2O3 |
|---|---|
| Molecular weight | 296.32 g/mol |
| IUPAC name | 5-methoxy-2-[4-(4-methoxyphenyl)-1H-pyrazol-5-yl]phenol |
| InChIKey | HSFFXTIWNUXDGF-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C(NN=C2)C3=C(C=C(C=C3)OC)O |
Computed by PubChem (NCBI)