Products 94909-90-7

CAS 94909-90-7 is the registry number for N-Methylpiperidinyl-2-methyl Benzilate. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 2mg, 5mg, 25mg.

Structural formula: {0} (CAS {1})

(1-methylpiperidin-2-yl)methyl 2-hydroxy-2,2-diphenylacetate (CAS 94909-90-7) is a chemical compound with the molecular formula C21H25NO3 and a molecular weight of 339.4 g/mol. IUPAC name: (1-methylpiperidin-2-yl)methyl 2-hydroxy-2,2-diphenylacetate. InChIKey: YKIFQNHBSLKZEO-UHFFFAOYSA-N.

Identity
Molecular formulaC21H25NO3
Molecular weight339.4 g/mol
IUPAC name(1-methylpiperidin-2-yl)methyl 2-hydroxy-2,2-diphenylacetate
InChIKeyYKIFQNHBSLKZEO-UHFFFAOYSA-N
SMILESCN1CCCCC1COC(=O)C(C2=CC=CC=C2)(C3=CC=CC=C3)O

Computed by PubChem (NCBI)