Products 949535-36-8
CAS 949535-36-8 is the registry number for (7-Chloroquinolin-4-yl)methanamine. Offered by: Biosynth. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 500mg.
(7-chloroquinolin-4-yl)methanamine (CAS 949535-36-8) is a chemical compound with the molecular formula C10H9ClN2 and a molecular weight of 192.64 g/mol. IUPAC name: (7-chloroquinolin-4-yl)methanamine. InChIKey: OCSYNOSHZBJPHR-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2 |
|---|---|
| Molecular weight | 192.64 g/mol |
| IUPAC name | (7-chloroquinolin-4-yl)methanamine |
| InChIKey | OCSYNOSHZBJPHR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2C=C1Cl)CN |
Computed by PubChem (NCBI)