CAS 94991-73-8 is the registry number for (R)-1-(2,6-Dimethylphenoxy)propan-2-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
(2R)-1-(2,6-dimethylphenoxy)propan-2-amine (CAS 94991-73-8) is a chemical compound with the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. IUPAC name: (2R)-1-(2,6-dimethylphenoxy)propan-2-amine. InChIKey: VLPIATFUUWWMKC-SNVBAGLBSA-N.
| Molecular formula | C11H17NO |
|---|---|
| Molecular weight | 179.26 g/mol |
| IUPAC name | (2R)-1-(2,6-dimethylphenoxy)propan-2-amine |
| InChIKey | VLPIATFUUWWMKC-SNVBAGLBSA-N |
| SMILES | CC1=C(C(=CC=C1)C)OC[C@@H](C)N |
Computed by PubChem (NCBI)