Products 950060-73-8
CAS 950060-73-8 is the registry number for Benzonitrile, 4-[[(2-chlorophenyl)methyl]amino]-, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg.
4-[(2-chlorophenyl)methylamino]benzonitrile (CAS 950060-73-8) is a chemical compound with the molecular formula C14H11ClN2 and a molecular weight of 242.70 g/mol. IUPAC name: 4-[(2-chlorophenyl)methylamino]benzonitrile. InChIKey: DATQDMJWMDOLMU-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2 |
|---|---|
| Molecular weight | 242.70 g/mol |
| IUPAC name | 4-[(2-chlorophenyl)methylamino]benzonitrile |
| InChIKey | DATQDMJWMDOLMU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CNC2=CC=C(C=C2)C#N)Cl |
Computed by PubChem (NCBI)