Products 950276-57-0
CAS 950276-57-0 is the registry number for 3-[3-(3-Chlorophenyl)-1,2,4-oxadiazol-5-yl]-2(1H)-pyridinone, 95%. Offered by: Chemat. Available pack sizes: 10mg, 25mg, 50mg.
3-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]-1H-pyridin-2-one (CAS 950276-57-0) is a chemical compound with the molecular formula C13H8ClN3O2 and a molecular weight of 273.67 g/mol. IUPAC name: 3-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]-1H-pyridin-2-one. InChIKey: VANAQTZNRUNJBH-UHFFFAOYSA-N.
| Molecular formula | C13H8ClN3O2 |
|---|---|
| Molecular weight | 273.67 g/mol |
| IUPAC name | 3-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]-1H-pyridin-2-one |
| InChIKey | VANAQTZNRUNJBH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=NOC(=N2)C3=CC=CNC3=O |
Computed by PubChem (NCBI)