CAS 95037-98-2 appears in our catalog under these names: Ethyl 2-(4-amino-3-fluorophenyl)propanoate, 98%, Flurbiprofen Impurity 34. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Ethyl 2-(4-amino-3-fluorophenyl)propanoate (CAS 95037-98-2) is a chemical compound with the molecular formula C11H14FNO2 and a molecular weight of 211.23 g/mol. IUPAC name: ethyl 2-(4-amino-3-fluorophenyl)propanoate. InChIKey: UXHLBQPDUXOYBB-UHFFFAOYSA-N.
| Molecular formula | C11H14FNO2 |
|---|---|
| Molecular weight | 211.23 g/mol |
| IUPAC name | ethyl 2-(4-amino-3-fluorophenyl)propanoate |
| InChIKey | UXHLBQPDUXOYBB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)C1=CC(=C(C=C1)N)F |
Computed by PubChem (NCBI)