CAS 951173-34-5 is the registry number for (1S,2R)-2-((tert-Butoxycarbonyl)amino)cyclobutane-1-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 5g.
Cis-(1S,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid (CAS 951173-34-5) is a chemical compound with the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. IUPAC name: cis-(1S,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid. InChIKey: JTMAFJQIPKPNFJ-NKWVEPMBSA-N.
| Molecular formula | C10H17NO4 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | cis-(1S,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid |
| InChIKey | JTMAFJQIPKPNFJ-NKWVEPMBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC[C@@H]1C(=O)O |
Computed by PubChem (NCBI)