CAS 951173-38-9 appears in our catalog under these names: (1R,2R)-2-((tert-Butoxycarbonyl)amino)cyclobutane-1-carboxylic acid, 98%, (1R,2R)-2-([(tert-Butoxy)carbonyl]amino)cyclobutane-1-carboxylic acid, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg, 500mg.
Trans-(1R,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid (CAS 951173-38-9) is a chemical compound with the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. IUPAC name: trans-(1R,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid. InChIKey: JTMAFJQIPKPNFJ-RNFRBKRXSA-N.
| Molecular formula | C10H17NO4 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | trans-(1R,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid |
| InChIKey | JTMAFJQIPKPNFJ-RNFRBKRXSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC[C@H]1C(=O)O |
Computed by PubChem (NCBI)