CAS 95123-61-8 appears in our catalog under these names: (E)-3-(4-(Trifluoromethyl)phenyl)acrylaldehyde 97%, (E)-3-(4-(Trifluoromethyl)phenyl)acrylaldehyde, 97%, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g.
(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enal (CAS 95123-61-8) is a chemical compound with the molecular formula C10H7F3O and a molecular weight of 200.16 g/mol. IUPAC name: (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enal. InChIKey: HYCDCKWWJCPUNT-OWOJBTEDSA-N.
| Molecular formula | C10H7F3O |
|---|---|
| Molecular weight | 200.16 g/mol |
| IUPAC name | (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enal |
| InChIKey | HYCDCKWWJCPUNT-OWOJBTEDSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C=O)C(F)(F)F |
Computed by PubChem (NCBI)