Products 952407-61-3
CAS 952407-61-3 is the registry number for L-Cystine-15N2, 99.00%. Offered by: MedChemExpress. Available pack sizes: 100 μg, 10 mg, 5 mg, 1 mg.
(2R)-2-(15N)azanyl-3-[[(2R)-2-(15N)azanyl-2-carboxyethyl]disulfanyl]propanoic acid (CAS 952407-61-3) is a chemical compound with the molecular formula C6H12N2O4S2 and a molecular weight of 242.3 g/mol. IUPAC name: (2R)-2-(15N)azanyl-3-[[(2R)-2-(15N)azanyl-2-carboxyethyl]disulfanyl]propanoic acid. InChIKey: LEVWYRKDKASIDU-NHLQVRHMSA-N.
| Molecular formula | C6H12N2O4S2 |
|---|---|
| Molecular weight | 242.3 g/mol |
| IUPAC name | (2R)-2-(15N)azanyl-3-[[(2R)-2-(15N)azanyl-2-carboxyethyl]disulfanyl]propanoic acid |
| InChIKey | LEVWYRKDKASIDU-NHLQVRHMSA-N |
| SMILES | C([C@@H](C(=O)O)[15NH2])SSC[C@@H](C(=O)O)[15NH2] |
Computed by PubChem (NCBI)
Synonyms:
L-Cystine-[15N2], L-Cystine-15N2, 98 atom % 15N